| Name | Disperse Violet 33 |
| Synonyms | Rubine CB Einecs 235-460-3 Disperse Violet CB Disperse Violet 33 disperse violet 33 C.I. Disperse Violet 33 C.I. Disperse Violet 33 press cake 2-[[4-[bis(2-hydroxyethyl)amino]-o-tolyl]azo]-5-nitrobenzonitrile 2-((4-(Bis(2-hydroxyethyl)amino)-o-tolyl)azo)-5-nitrobenzonitrile 2-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]azo]-5-nitrobenzonitrile 2-[(E)-{4-[bis(2-hydroxyethyl)amino]-2-methylphenyl}diazenyl]-5-nitrobenzonitrilato |
| CAS | 12236-25-8 |
| EINECS | 235-460-3 |
| InChI | InChI=1/C18H19N5O4/c1-13-10-15(22(6-8-24)7-9-25)2-4-17(13)20-21-18-5-3-16(23(26)27)11-14(18)12-19/h2-5,10-11,24-25H,6-9H2,1H3/b21-20+ |
| Molecular Formula | C18H19N5O4 |
| Molar Mass | 369.37456 |
| Density | 1.31[at 20℃] |
| Boling Point | 559.33℃[at 101 325 Pa] |
| Flash Point | 343.8°C |
| Water Solubility | 61.338mg/L at 25℃ |
| Vapor Presure | 0Pa at 25℃ |
| Refractive Index | 1.625 |
| LogP | 3.24 at 25℃ |
| EPA chemical substance information | information provided by: iaspub.epa.gov (external link) |
| Use | can be used for dyeing and printing of polyester and its blends |